C25H47O3P — CID 88763207
trihydroxy-octan-2-yl-(2,4,6-trimethyl-3-octan-2-ylphenyl)-λ5-phosphane (PubChem CID 88763207) has the molecular formula C25H47O3P and a molecular weight of 426.62 g/mol. Its IUPAC name is trihydroxy-octan-2-yl-(2,4,6-trimethyl-3-octan-2-ylphenyl)-λ5-phosphane.
| Compound Name | trihydroxy-octan-2-yl-(2,4,6-trimethyl-3-octan-2-ylphenyl)-λ5-phosphane |
|---|---|
| PubChem CID | 88763207 |
| Molecular Formula | C25H47O3P |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | trihydroxy-octan-2-yl-(2,4,6-trimethyl-3-octan-2-ylphenyl)-λ5-phosphane |
| SMILES | CCCCCCC(C)c1c(C)cc(C)c(P(O)(O)(O)C(C)CCCCCC)c1C |
| InChI | InChI=1S/C25H47O3P/c1-8-10-12-14-16-19(3)24-20(4)18-21(5)25(23(24)7)29(26,27,28)22(6)17-15-13-11-9-2/h18-19,22,26-28H,8-17H2,1-7H3 |
| InChIKey | KYQOUMXLAKJIJY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|