C23H40O6 — CID 88765517
[(1E,3E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoctyl]cyclopentyl]hepta-1,3-dienyl] 2-methoxyacetate (PubChem CID 88765517) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is [(1E,3E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoctyl]cyclopentyl]hepta-1,3-dienyl] 2-methoxyacetate.
| Compound Name | [(1E,3E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoctyl]cyclopentyl]hepta-1,3-dienyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 88765517 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | [(1E,3E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoctyl]cyclopentyl]hepta-1,3-dienyl] 2-methoxyacetate |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@@H](CCC/C=C/C=C/OC(=O)COC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H40O6/c1-3-4-8-11-18(24)13-14-20-19(21(25)16-22(20)26)12-9-6-5-7-10-15-29-23(27)17-28-2/h5,7,10,15,18-22,24-26H,3-4,6,8-9,11-14,16-17H2,1-2H3/b7-5+,15-10+/t18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | UADIZBGVLVJFQN-IYYDTHCTSA-N |
| XLogP | 3.50 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|