C12H14ClNO4Sn — CID 88771027
(2-chloroacetyl)-[[(3,5-dimethoxybenzoyl)amino]methyl]tin (PubChem CID 88771027) has the molecular formula C12H14ClNO4Sn and a molecular weight of 390.41 g/mol. Its IUPAC name is (2-chloroacetyl)-[[(3,5-dimethoxybenzoyl)amino]methyl]tin.
| Compound Name | (2-chloroacetyl)-[[(3,5-dimethoxybenzoyl)amino]methyl]tin |
|---|---|
| PubChem CID | 88771027 |
| Molecular Formula | C12H14ClNO4Sn |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | (2-chloroacetyl)-[[(3,5-dimethoxybenzoyl)amino]methyl]tin |
| SMILES | COc1cc(OC)cc(C(=O)NC[Sn]C(=O)CCl)c1 |
| InChI | InChI=1S/C10H12NO3.C2H2ClO.Sn/c1-11-10(12)7-4-8(13-2)6-9(5-7)14-3;3-1-2-4;/h4-6H,1H2,2-3H3,(H,11,12);1H2; |
| InChIKey | ZLOYDLLPJQIBKU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|