About 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate
2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate (PubChem CID 88772687) has the molecular formula C13H19BrN2O3
and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate |
| PubChem CID | 88772687 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate |
| SMILES | Cc1c(C(=O)OCCO)cc(NC(C)C)c(N)c1Br |
| InChI | InChI=1S/C13H19BrN2O3/c1-7(2)16-10-6-9(13(18)19-5-4-17)8(3)11(14)12(10)15/h6-7,16-17H,4-5,15H2,1-3H3 |
| InChIKey | ZLBHFXWGEKPOEQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate?
The IUPAC name of 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate (CID 88772687) is 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate.
What is the SMILES notation for 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate?
The canonical SMILES for 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate is Cc1c(C(=O)OCCO)cc(NC(C)C)c(N)c1Br.
What is the InChIKey of 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate?
The InChIKey is ZLBHFXWGEKPOEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrN2O3/c1-7(2)16-10-6-9(13(18)19-5-4-17)8(3)11(14)12(10)15/h6-7,16-17H,4-5,15H2,1-3H3.
What are the key properties of 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate?
2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate has a molecular weight of 331.21 g/mol, XLogP of 2.31, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 4-amino-3-bromo-2-methyl-5-(propan-2-ylamino)benzoate is sourced from PubChem (CID 88772687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).