About sodium;trichlororuthenium;acetate
sodium;trichlororuthenium;acetate (PubChem CID 88775661) has the molecular formula C2H3Cl3NaO2Ru
and a molecular weight of 289.46 g/mol. Its IUPAC name is sodium;trichlororuthenium;acetate.
Molecular Properties
| Compound Name | sodium;trichlororuthenium;acetate |
| PubChem CID | 88775661 |
| Molecular Formula | C2H3Cl3NaO2Ru |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 288.81 |
| IUPAC Name | sodium;trichlororuthenium;acetate |
| SMILES | CC(=O)[O-].Cl[Ru](Cl)Cl.[Na+] |
| InChI | InChI=1S/C2H4O2.3ClH.Na.Ru/c1-2(3)4;;;;;/h1H3,(H,3,4);3*1H;;/q;;;;+1;+3/p-4 |
| InChIKey | NZIYKQMTPJOZPP-UHFFFAOYSA-J |
| XLogP | -2.17 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;trichlororuthenium;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;trichlororuthenium;acetate?
The IUPAC name of sodium;trichlororuthenium;acetate (CID 88775661) is sodium;trichlororuthenium;acetate.
What is the SMILES notation for sodium;trichlororuthenium;acetate?
The canonical SMILES for sodium;trichlororuthenium;acetate is CC(=O)[O-].Cl[Ru](Cl)Cl.[Na+].
What is the InChIKey of sodium;trichlororuthenium;acetate?
The InChIKey is NZIYKQMTPJOZPP-UHFFFAOYSA-J. The full InChI is InChI=1S/C2H4O2.3ClH.Na.Ru/c1-2(3)4;;;;;/h1H3,(H,3,4);3*1H;;/q;;;;+1;+3/p-4.
What are the key properties of sodium;trichlororuthenium;acetate?
sodium;trichlororuthenium;acetate has a molecular weight of 289.46 g/mol, XLogP of -2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;trichlororuthenium;acetate is sourced from PubChem (CID 88775661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).