C4H8N5O2PS2 — CID 88786332
6-(dihydroxyphosphinothioylsulfanylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 88786332) has the molecular formula C4H8N5O2PS2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 6-(dihydroxyphosphinothioylsulfanylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(dihydroxyphosphinothioylsulfanylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 88786332 |
| Molecular Formula | C4H8N5O2PS2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | 6-(dihydroxyphosphinothioylsulfanylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(CSP(O)(O)=S)n1 |
| InChI | InChI=1S/C4H8N5O2PS2/c5-3-7-2(8-4(6)9-3)1-14-12(10,11)13/h1H2,(H2,10,11,13)(H4,5,6,7,8,9) |
| InChIKey | LBGBYQAKAMFMHA-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|