C19H26O3 — CID 88788499
(E)-3-methyl-5-(2,5,5-trimethyl-3-oxo-4-pentoxycyclopenten-1-yl)pent-2-en-4-ynal (PubChem CID 88788499) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (E)-3-methyl-5-(2,5,5-trimethyl-3-oxo-4-pentoxycyclopenten-1-yl)pent-2-en-4-ynal.
| Compound Name | (E)-3-methyl-5-(2,5,5-trimethyl-3-oxo-4-pentoxycyclopenten-1-yl)pent-2-en-4-ynal |
|---|---|
| PubChem CID | 88788499 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (E)-3-methyl-5-(2,5,5-trimethyl-3-oxo-4-pentoxycyclopenten-1-yl)pent-2-en-4-ynal |
| SMILES | CCCCCOC1C(=O)C(C)=C(C#C/C(C)=C/C=O)C1(C)C |
| InChI | InChI=1S/C19H26O3/c1-6-7-8-13-22-18-17(21)15(3)16(19(18,4)5)10-9-14(2)11-12-20/h11-12,18H,6-8,13H2,1-5H3/b14-11+ |
| InChIKey | YPODAPQCELRJLZ-SDNWHVSQSA-N |
| XLogP | 3.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|