C14H19Br4O4P — CID 88795400
4-[2-[2,3-dibromopropoxy(2,3-dibromopropyl)phosphoryl]oxyethyl]phenol (PubChem CID 88795400) has the molecular formula C14H19Br4O4P and a molecular weight of 601.89 g/mol. Its IUPAC name is 4-[2-[2,3-dibromopropoxy(2,3-dibromopropyl)phosphoryl]oxyethyl]phenol.
| Compound Name | 4-[2-[2,3-dibromopropoxy(2,3-dibromopropyl)phosphoryl]oxyethyl]phenol |
|---|---|
| PubChem CID | 88795400 |
| Molecular Formula | C14H19Br4O4P |
| Molecular Weight | 601.89 g/mol |
| Exact Mass | 597.78 |
| IUPAC Name | 4-[2-[2,3-dibromopropoxy(2,3-dibromopropyl)phosphoryl]oxyethyl]phenol |
| SMILES | O=P(CC(Br)CBr)(OCCc1ccc(O)cc1)OCC(Br)CBr |
| InChI | InChI=1S/C14H19Br4O4P/c15-7-12(17)9-22-23(20,10-13(18)8-16)21-6-5-11-1-3-14(19)4-2-11/h1-4,12-13,19H,5-10H2 |
| InChIKey | KGNHNDZYSCPCAE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|