C26H19N4O3SZn- — CID 88803007
benzene;21,22-dihydroporphyrin-2-sulfonic acid;zinc (PubChem CID 88803007) has the molecular formula C26H19N4O3SZn- and a molecular weight of 532.92 g/mol. Its IUPAC name is benzene;21,22-dihydroporphyrin-2-sulfonic acid;zinc.
| Compound Name | benzene;21,22-dihydroporphyrin-2-sulfonic acid;zinc |
|---|---|
| PubChem CID | 88803007 |
| Molecular Formula | C26H19N4O3SZn- |
| Molecular Weight | 532.92 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | benzene;21,22-dihydroporphyrin-2-sulfonic acid;zinc |
| SMILES | O=S(=O)(O)c1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3.[Zn].[c-]1ccccc1 |
| InChI | InChI=1S/C20H14N4O3S.C6H5.Zn/c25-28(26,27)20-11-18-9-16-4-3-14(22-16)7-12-1-2-13(21-12)8-15-5-6-17(23-15)10-19(20)24-18;1-2-4-6-5-3-1;/h1-11,22,24H,(H,25,26,27);1-5H;/q;-1;/b12-7-,13-8-,14-7-,15-8-,16-9-,17-10-,18-9-,19-10-;; |
| InChIKey | MNJZGLDRMOSISD-NSEHVRSHSA-N |
| XLogP | 5.39 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.92 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|