C26H18MnN4O2S — CID 175023826
2-(benzenesulfonyl)-21,22-dihydroporphyrin;manganese (PubChem CID 175023826) has the molecular formula C26H18MnN4O2S and a molecular weight of 505.46 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-21,22-dihydroporphyrin;manganese.
| Compound Name | 2-(benzenesulfonyl)-21,22-dihydroporphyrin;manganese |
|---|---|
| PubChem CID | 175023826 |
| Molecular Formula | C26H18MnN4O2S |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | 2-(benzenesulfonyl)-21,22-dihydroporphyrin;manganese |
| SMILES | O=S(=O)(c1ccccc1)c1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3.[Mn] |
| InChI | InChI=1S/C26H18N4O2S.Mn/c31-33(32,24-4-2-1-3-5-24)26-16-23-14-21-9-8-19(28-21)12-17-6-7-18(27-17)13-20-10-11-22(29-20)15-25(26)30-23;/h1-16,28,30H;/b17-12-,18-13-,19-12-,20-13-,21-14-,22-15-,23-14-,25-15-; |
| InChIKey | SARPOAJBNQBMHH-LNUQMWHKSA-N |
| XLogP | 5.49 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |