C22H21N3O4S — CID 88811313
5-[2-(2-cyanoethyl)-2-(3-methylphenyl)hydrazinyl]-2-phenoxybenzenesulfonic acid (PubChem CID 88811313) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 5-[2-(2-cyanoethyl)-2-(3-methylphenyl)hydrazinyl]-2-phenoxybenzenesulfonic acid.
| Compound Name | 5-[2-(2-cyanoethyl)-2-(3-methylphenyl)hydrazinyl]-2-phenoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 88811313 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 5-[2-(2-cyanoethyl)-2-(3-methylphenyl)hydrazinyl]-2-phenoxybenzenesulfonic acid |
| SMILES | Cc1cccc(N(CCC#N)Nc2ccc(Oc3ccccc3)c(S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C22H21N3O4S/c1-17-7-5-8-19(15-17)25(14-6-13-23)24-18-11-12-21(22(16-18)30(26,27)28)29-20-9-3-2-4-10-20/h2-5,7-12,15-16,24H,6,14H2,1H3,(H,26,27,28) |
| InChIKey | JWMBSPRIKOBSGQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|