C34H40Cl2N2P2Pd — CID 88813042
dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) (PubChem CID 88813042) has the molecular formula C34H40Cl2N2P2Pd and a molecular weight of 715.98 g/mol. Its IUPAC name is dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane).
| Compound Name | dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) |
|---|---|
| PubChem CID | 88813042 |
| Molecular Formula | C34H40Cl2N2P2Pd |
| Molecular Weight | 715.98 g/mol |
| Exact Mass | 714.11 |
| IUPAC Name | dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) |
| SMILES | Cl[Pd]Cl.c1ccc(P(c2ccccc2)N2CCCCC2)cc1.c1ccc(P(c2ccccc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/2C17H20NP.2ClH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-2,4-7,10-13H,3,8-9,14-15H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | KEWSGOQKIRNBOJ-UHFFFAOYSA-L |
| XLogP | 8.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.98 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|