About dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane)
dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) (PubChem CID 88813042) has the molecular formula C34H40Cl2N2P2Pd
and a molecular weight of 715.98 g/mol. Its IUPAC name is dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane).
Molecular Properties
| Compound Name | dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) |
| PubChem CID | 88813042 |
| Molecular Formula | C34H40Cl2N2P2Pd |
| Molecular Weight | 715.98 g/mol |
| Exact Mass | 714.11 |
| IUPAC Name | dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) |
| SMILES | Cl[Pd]Cl.c1ccc(P(c2ccccc2)N2CCCCC2)cc1.c1ccc(P(c2ccccc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/2C17H20NP.2ClH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-2,4-7,10-13H,3,8-9,14-15H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | KEWSGOQKIRNBOJ-UHFFFAOYSA-L |
| XLogP | 8.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 715.98 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane)?
The IUPAC name of dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) (CID 88813042) is dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane).
What is the SMILES notation for dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane)?
The canonical SMILES for dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) is Cl[Pd]Cl.c1ccc(P(c2ccccc2)N2CCCCC2)cc1.c1ccc(P(c2ccccc2)N2CCCCC2)cc1.
What is the InChIKey of dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane)?
The InChIKey is KEWSGOQKIRNBOJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C17H20NP.2ClH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-2,4-7,10-13H,3,8-9,14-15H2;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane)?
dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) has a molecular weight of 715.98 g/mol, XLogP of 8.42, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;bis(diphenyl(piperidin-1-yl)phosphane) is sourced from PubChem (CID 88813042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).