C15H15N2P — CID 91105862
4,5-dihydroimidazol-1-yl(diphenyl)phosphane (PubChem CID 91105862) has the molecular formula C15H15N2P and a molecular weight of 254.27 g/mol. Its IUPAC name is 4,5-dihydroimidazol-1-yl(diphenyl)phosphane.
| Compound Name | 4,5-dihydroimidazol-1-yl(diphenyl)phosphane |
|---|---|
| PubChem CID | 91105862 |
| Molecular Formula | C15H15N2P |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 4,5-dihydroimidazol-1-yl(diphenyl)phosphane |
| SMILES | C1=NCCN1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15N2P/c1-3-7-14(8-4-1)18(17-12-11-16-13-17)15-9-5-2-6-10-15/h1-10,13H,11-12H2 |
| InChIKey | YAMLNPKMVYFVHK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|