C13H18N4 — CID 159013439
1-benzyl-4,5-dihydroimidazole;4,5-dihydro-1H-imidazole (PubChem CID 159013439) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-benzyl-4,5-dihydroimidazole;4,5-dihydro-1H-imidazole.
| Compound Name | 1-benzyl-4,5-dihydroimidazole;4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 159013439 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-benzyl-4,5-dihydroimidazole;4,5-dihydro-1H-imidazole |
| SMILES | C1=NCCN1.C1=NCCN1Cc1ccccc1 |
| InChI | InChI=1S/C10H12N2.C3H6N2/c1-2-4-10(5-3-1)8-12-7-6-11-9-12;1-2-5-3-4-1/h1-5,9H,6-8H2;3H,1-2H2,(H,4,5) |
| InChIKey | JSUBDPOKNVLIEI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |