C11H14N2 — CID 142271206
4-benzyl-3,5-dihydro-2H-pyrazine (PubChem CID 142271206) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 4-benzyl-3,5-dihydro-2H-pyrazine.
| Compound Name | 4-benzyl-3,5-dihydro-2H-pyrazine |
|---|---|
| PubChem CID | 142271206 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 4-benzyl-3,5-dihydro-2H-pyrazine |
| SMILES | C1=NCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C11H14N2/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13/h1-6H,7-10H2 |
| InChIKey | LYAQXBIPMOZRHH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |