C30H39N3P2 — CID 88816907
diphenyl(pyrrolidin-1-yl)phosphane;phenyl(dipyrrolidin-1-yl)phosphane (PubChem CID 88816907) has the molecular formula C30H39N3P2 and a molecular weight of 503.61 g/mol. Its IUPAC name is diphenyl(pyrrolidin-1-yl)phosphane;phenyl(dipyrrolidin-1-yl)phosphane.
| Compound Name | diphenyl(pyrrolidin-1-yl)phosphane;phenyl(dipyrrolidin-1-yl)phosphane |
|---|---|
| PubChem CID | 88816907 |
| Molecular Formula | C30H39N3P2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | diphenyl(pyrrolidin-1-yl)phosphane;phenyl(dipyrrolidin-1-yl)phosphane |
| SMILES | c1ccc(P(N2CCCC2)N2CCCC2)cc1.c1ccc(P(c2ccccc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C16H18NP.C14H21N2P/c1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;1-2-8-14(9-3-1)17(15-10-4-5-11-15)16-12-6-7-13-16/h1-6,9-12H,7-8,13-14H2;1-3,8-9H,4-7,10-13H2 |
| InChIKey | LTUIIHACTVPNFK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|