C22H32O5 — CID 88816820
(2R,5E,8Z,10S)-10-ethynyl-2,10-dihydroxy-2-[(1R)-2-oxocyclopentyl]pentadeca-5,8-dienoic acid (PubChem CID 88816820) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is (2R,5E,8Z,10S)-10-ethynyl-2,10-dihydroxy-2-[(1R)-2-oxocyclopentyl]pentadeca-5,8-dienoic acid.
| Compound Name | (2R,5E,8Z,10S)-10-ethynyl-2,10-dihydroxy-2-[(1R)-2-oxocyclopentyl]pentadeca-5,8-dienoic acid |
|---|---|
| PubChem CID | 88816820 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (2R,5E,8Z,10S)-10-ethynyl-2,10-dihydroxy-2-[(1R)-2-oxocyclopentyl]pentadeca-5,8-dienoic acid |
| SMILES | C#C[C@@](O)(/C=C\C/C=C/CC[C@](O)(C(=O)O)[C@H]1CCCC1=O)CCCCC |
| InChI | InChI=1S/C22H32O5/c1-3-5-9-15-21(26,4-2)16-10-7-6-8-11-17-22(27,20(24)25)18-13-12-14-19(18)23/h2,6,8,10,16,18,26-27H,3,5,7,9,11-15,17H2,1H3,(H,24,25)/b8-6+,16-10-/t18-,21-,22+/m0/s1 |
| InChIKey | YLYTXGAKWNNJEO-FNKXDBSASA-N |
| XLogP | 3.40 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|