C21H34O4 — CID 57053394
(2S)-10-hydroxy-10-methyl-2-[(1R)-2-oxocyclopentyl]pentadeca-5,8-dienoic acid (PubChem CID 57053394) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2S)-10-hydroxy-10-methyl-2-[(1R)-2-oxocyclopentyl]pentadeca-5,8-dienoic acid.
| Compound Name | (2S)-10-hydroxy-10-methyl-2-[(1R)-2-oxocyclopentyl]pentadeca-5,8-dienoic acid |
|---|---|
| PubChem CID | 57053394 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (2S)-10-hydroxy-10-methyl-2-[(1R)-2-oxocyclopentyl]pentadeca-5,8-dienoic acid |
| SMILES | CCCCCC(C)(O)C=CCC=CCC[C@H](C(=O)O)[C@H]1CCCC1=O |
| InChI | InChI=1S/C21H34O4/c1-3-4-9-15-21(2,25)16-10-7-5-6-8-12-18(20(23)24)17-13-11-14-19(17)22/h5-6,10,16-18,25H,3-4,7-9,11-15H2,1-2H3,(H,23,24)/t17-,18+,21?/m1/s1 |
| InChIKey | KANPREIQLJVDRV-IZKAZRHKSA-N |
| XLogP | 4.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|