C21H31F3O4 — CID 57083242
(2S)-8-oxo-2-[(1R)-2-oxocyclopentyl]-11-(trifluoromethyl)pentadec-5-enoic acid (PubChem CID 57083242) has the molecular formula C21H31F3O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is (2S)-8-oxo-2-[(1R)-2-oxocyclopentyl]-11-(trifluoromethyl)pentadec-5-enoic acid.
| Compound Name | (2S)-8-oxo-2-[(1R)-2-oxocyclopentyl]-11-(trifluoromethyl)pentadec-5-enoic acid |
|---|---|
| PubChem CID | 57083242 |
| Molecular Formula | C21H31F3O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (2S)-8-oxo-2-[(1R)-2-oxocyclopentyl]-11-(trifluoromethyl)pentadec-5-enoic acid |
| SMILES | CCCCC(CCC(=O)CC=CCC[C@H](C(=O)O)[C@H]1CCCC1=O)C(F)(F)F |
| InChI | InChI=1S/C21H31F3O4/c1-2-3-8-15(21(22,23)24)13-14-16(25)9-5-4-6-10-18(20(27)28)17-11-7-12-19(17)26/h4-5,15,17-18H,2-3,6-14H2,1H3,(H,27,28)/t15?,17-,18+/m1/s1 |
| InChIKey | IWABQLVMUGKNJY-KVJCIMDZSA-N |
| XLogP | 5.50 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|