C25H38O4Si — CID 57141080
(2S,10S)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadec-8-en-5-ynoic acid (PubChem CID 57141080) has the molecular formula C25H38O4Si and a molecular weight of 430.66 g/mol. Its IUPAC name is (2S,10S)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadec-8-en-5-ynoic acid.
| Compound Name | (2S,10S)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadec-8-en-5-ynoic acid |
|---|---|
| PubChem CID | 57141080 |
| Molecular Formula | C25H38O4Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (2S,10S)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadec-8-en-5-ynoic acid |
| SMILES | CCCCC[C@@](O)(C#C[Si](C)(C)C)C=CCC#CCC[C@H](C(=O)O)[C@H]1CCCC1=O |
| InChI | InChI=1S/C25H38O4Si/c1-5-6-11-17-25(29,19-20-30(2,3)4)18-12-9-7-8-10-14-22(24(27)28)21-15-13-16-23(21)26/h12,18,21-22,29H,5-6,9-11,13-17H2,1-4H3,(H,27,28)/t21-,22+,25+/m1/s1 |
| InChIKey | XGARSZZATOUUKI-SLSDLSHTSA-N |
| XLogP | 4.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|