C28H48O4Si — CID 57037061
7-[(1R,2S)-2-[4-hydroxy-4-(2-trimethylsilylethynyl)decyl]-5-oxocyclopentyl]-6-methylhept-2-enoic acid (PubChem CID 57037061) has the molecular formula C28H48O4Si and a molecular weight of 476.77 g/mol. Its IUPAC name is 7-[(1R,2S)-2-[4-hydroxy-4-(2-trimethylsilylethynyl)decyl]-5-oxocyclopentyl]-6-methylhept-2-enoic acid.
| Compound Name | 7-[(1R,2S)-2-[4-hydroxy-4-(2-trimethylsilylethynyl)decyl]-5-oxocyclopentyl]-6-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 57037061 |
| Molecular Formula | C28H48O4Si |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | 7-[(1R,2S)-2-[4-hydroxy-4-(2-trimethylsilylethynyl)decyl]-5-oxocyclopentyl]-6-methylhept-2-enoic acid |
| SMILES | CCCCCCC(O)(C#C[Si](C)(C)C)CCC[C@H]1CCC(=O)[C@@H]1CC(C)CCC=CC(=O)O |
| InChI | InChI=1S/C28H48O4Si/c1-6-7-8-11-18-28(32,20-21-33(3,4)5)19-12-14-24-16-17-26(29)25(24)22-23(2)13-9-10-15-27(30)31/h10,15,23-25,32H,6-9,11-14,16-19,22H2,1-5H3,(H,30,31)/t23?,24-,25+,28?/m0/s1 |
| InChIKey | GLHADQAKKODRJD-QDBPJBAASA-N |
| XLogP | 6.78 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|