C25H40O4Si — CID 70626998
(2S,5E,8Z,10R)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadeca-5,8-dienoic acid (PubChem CID 70626998) has the molecular formula C25H40O4Si and a molecular weight of 432.68 g/mol. Its IUPAC name is (2S,5E,8Z,10R)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadeca-5,8-dienoic acid.
| Compound Name | (2S,5E,8Z,10R)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadeca-5,8-dienoic acid |
|---|---|
| PubChem CID | 70626998 |
| Molecular Formula | C25H40O4Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (2S,5E,8Z,10R)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadeca-5,8-dienoic acid |
| SMILES | CCCCC[C@](O)(C#C[Si](C)(C)C)/C=C\C/C=C/CC[C@H](C(=O)O)[C@H]1CCCC1=O |
| InChI | InChI=1S/C25H40O4Si/c1-5-6-11-17-25(29,19-20-30(2,3)4)18-12-9-7-8-10-14-22(24(27)28)21-15-13-16-23(21)26/h7-8,12,18,21-22,29H,5-6,9-11,13-17H2,1-4H3,(H,27,28)/b8-7+,18-12-/t21-,22+,25-/m1/s1 |
| InChIKey | AWPNKUCQRMGQHU-DPIXZAASSA-N |
| XLogP | 5.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|