C26H42O4Si — CID 57211721
methyl (2S,10R)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadeca-5,8-dienoate (PubChem CID 57211721) has the molecular formula C26H42O4Si and a molecular weight of 446.70 g/mol. Its IUPAC name is methyl (2S,10R)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadeca-5,8-dienoate.
| Compound Name | methyl (2S,10R)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadeca-5,8-dienoate |
|---|---|
| PubChem CID | 57211721 |
| Molecular Formula | C26H42O4Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | methyl (2S,10R)-10-hydroxy-2-[(1R)-2-oxocyclopentyl]-10-(2-trimethylsilylethynyl)pentadeca-5,8-dienoate |
| SMILES | CCCCC[C@](O)(C#C[Si](C)(C)C)C=CCC=CCC[C@H](C(=O)OC)[C@H]1CCCC1=O |
| InChI | InChI=1S/C26H42O4Si/c1-6-7-12-18-26(29,20-21-31(3,4)5)19-13-10-8-9-11-15-23(25(28)30-2)22-16-14-17-24(22)27/h8-9,13,19,22-23,29H,6-7,10-12,14-18H2,1-5H3/t22-,23+,26-/m1/s1 |
| InChIKey | SKTAEIMXPIKQNU-MVERNJQCSA-N |
| XLogP | 5.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|