About 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid
3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid (PubChem CID 88817402) has the molecular formula C8H11ClN2O5S2
and a molecular weight of 314.77 g/mol. Its IUPAC name is 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid.
Molecular Properties
| Compound Name | 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid |
| PubChem CID | 88817402 |
| Molecular Formula | C8H11ClN2O5S2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid |
| SMILES | Nc1cccc(Cl)c1.O=S(=O)=NCCS(=O)(=O)O |
| InChI | InChI=1S/C6H6ClN.C2H5NO5S2/c7-5-2-1-3-6(8)4-5;4-9(5)3-1-2-10(6,7)8/h1-4H,8H2;1-2H2,(H,6,7,8) |
| InChIKey | WCNOUDGNMFVOHA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid?
The IUPAC name of 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid (CID 88817402) is 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid.
What is the SMILES notation for 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid?
The canonical SMILES for 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid is Nc1cccc(Cl)c1.O=S(=O)=NCCS(=O)(=O)O.
What is the InChIKey of 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid?
The InChIKey is WCNOUDGNMFVOHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.C2H5NO5S2/c7-5-2-1-3-6(8)4-5;4-9(5)3-1-2-10(6,7)8/h1-4H,8H2;1-2H2,(H,6,7,8).
What are the key properties of 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid?
3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid has a molecular weight of 314.77 g/mol, XLogP of 0.86, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloroaniline;2-(sulfonylamino)ethanesulfonic acid is sourced from PubChem (CID 88817402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).