C16H34N2O4 — CID 88817450
2-ethyl-3-(hydroxymethyl)hexanamide;3-(hydroxymethyl)-2-methylpentanamide (PubChem CID 88817450) has the molecular formula C16H34N2O4 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-ethyl-3-(hydroxymethyl)hexanamide;3-(hydroxymethyl)-2-methylpentanamide.
| Compound Name | 2-ethyl-3-(hydroxymethyl)hexanamide;3-(hydroxymethyl)-2-methylpentanamide |
|---|---|
| PubChem CID | 88817450 |
| Molecular Formula | C16H34N2O4 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | 2-ethyl-3-(hydroxymethyl)hexanamide;3-(hydroxymethyl)-2-methylpentanamide |
| SMILES | CCC(CO)C(C)C(N)=O.CCCC(CO)C(CC)C(N)=O |
| InChI | InChI=1S/C9H19NO2.C7H15NO2/c1-3-5-7(6-11)8(4-2)9(10)12;1-3-6(4-9)5(2)7(8)10/h7-8,11H,3-6H2,1-2H3,(H2,10,12);5-6,9H,3-4H2,1-2H3,(H2,8,10) |
| InChIKey | BUOKQVXEPQVZMG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |