About (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate
(2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate (PubChem CID 88823965) has the molecular formula C7H8ClNO5
and a molecular weight of 221.60 g/mol. Its IUPAC name is (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate.
Molecular Properties
| Compound Name | (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate |
| PubChem CID | 88823965 |
| Molecular Formula | C7H8ClNO5 |
| Molecular Weight | 221.60 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate |
| SMILES | CC1(OC(=O)CCl)CC=C([N+](=O)[O-])O1 |
| InChI | InChI=1S/C7H8ClNO5/c1-7(14-6(10)4-8)3-2-5(13-7)9(11)12/h2H,3-4H2,1H3 |
| InChIKey | JDEPZFBSZPBXLU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.60 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate?
The IUPAC name of (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate (CID 88823965) is (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate.
What is the SMILES notation for (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate?
The canonical SMILES for (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate is CC1(OC(=O)CCl)CC=C([N+](=O)[O-])O1.
What is the InChIKey of (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate?
The InChIKey is JDEPZFBSZPBXLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO5/c1-7(14-6(10)4-8)3-2-5(13-7)9(11)12/h2H,3-4H2,1H3.
What are the key properties of (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate?
(2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate has a molecular weight of 221.60 g/mol, XLogP of 1.02, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-5-nitro-3H-furan-2-yl) 2-chloroacetate is sourced from PubChem (CID 88823965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).