C10H18N4O2S — CID 88826570
1-[2-(1,2-oxazol-3-ylmethylamino)ethylsulfanyl]-3-propylurea (PubChem CID 88826570) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-[2-(1,2-oxazol-3-ylmethylamino)ethylsulfanyl]-3-propylurea.
| Compound Name | 1-[2-(1,2-oxazol-3-ylmethylamino)ethylsulfanyl]-3-propylurea |
|---|---|
| PubChem CID | 88826570 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[2-(1,2-oxazol-3-ylmethylamino)ethylsulfanyl]-3-propylurea |
| SMILES | CCCNC(=O)NSCCNCc1ccon1 |
| InChI | InChI=1S/C10H18N4O2S/c1-2-4-12-10(15)14-17-7-5-11-8-9-3-6-16-13-9/h3,6,11H,2,4-5,7-8H2,1H3,(H2,12,14,15) |
| InChIKey | CNLGRLYXWJCVMJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|