About CID 88828446
CID 88828446 (PubChem CID 88828446) has the molecular formula C52H100N2O10S2
and a molecular weight of 977.51 g/mol.
Molecular Properties
| Compound Name | CID 88828446 |
| PubChem CID | 88828446 |
| Molecular Formula | C52H100N2O10S2 |
| Molecular Weight | 977.51 g/mol |
| Exact Mass | 976.68 |
| IUPAC Name | — |
| SMILES | CCCCCCCC(=O)[N+](CC)(C(=O)CCCCCCC)C(=O)CCCCCCC.CCCCCCCC(=O)[N+](CC)(C(=O)CCCCCCC)C(=O)CCCCCCC.O=S([O-])S(=O)[O-] |
| InChI | InChI=1S/2C26H50NO3.H2O4S2/c2*1-5-9-12-15-18-21-24(28)27(8-4,25(29)22-19-16-13-10-6-2)26(30)23-20-17-14-11-7-3;1-5(2)6(3)4/h2*5-23H2,1-4H3;(H,1,2)(H,3,4)/q2*+1;/p-2 |
| InChIKey | PEQCMZQXZDRDGK-UHFFFAOYSA-L |
| XLogP | 13.63 |
| TPSA | 182.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 977.51 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 88828446 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88828446?
The IUPAC name of CID 88828446 (CID 88828446) is not available.
What is the SMILES notation for CID 88828446?
The canonical SMILES for CID 88828446 is CCCCCCCC(=O)[N+](CC)(C(=O)CCCCCCC)C(=O)CCCCCCC.CCCCCCCC(=O)[N+](CC)(C(=O)CCCCCCC)C(=O)CCCCCCC.O=S([O-])S(=O)[O-].
What is the InChIKey of CID 88828446?
The InChIKey is PEQCMZQXZDRDGK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C26H50NO3.H2O4S2/c2*1-5-9-12-15-18-21-24(28)27(8-4,25(29)22-19-16-13-10-6-2)26(30)23-20-17-14-11-7-3;1-5(2)6(3)4/h2*5-23H2,1-4H3;(H,1,2)(H,3,4)/q2*+1;/p-2.
What are the key properties of CID 88828446?
CID 88828446 has a molecular weight of 977.51 g/mol, XLogP of 13.63, 39 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88828446 is sourced from PubChem (CID 88828446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).