C19H28N2O2 — CID 88830694
5,6-bis(1-isocyanatopentyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 88830694) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 5,6-bis(1-isocyanatopentyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,6-bis(1-isocyanatopentyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 88830694 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 5,6-bis(1-isocyanatopentyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | CCCCC(N=C=O)C1C2C=CC(C2)C1C(CCCC)N=C=O |
| InChI | InChI=1S/C19H28N2O2/c1-3-5-7-16(20-12-22)18-14-9-10-15(11-14)19(18)17(21-13-23)8-6-4-2/h9-10,14-19H,3-8,11H2,1-2H3 |
| InChIKey | KSUHIYBCTYRPAZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|