C15H29NO — CID 88844803
(2E,4E)-10-methoxy-2,7,10-trimethylundeca-2,4-dien-1-amine (PubChem CID 88844803) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is (2E,4E)-10-methoxy-2,7,10-trimethylundeca-2,4-dien-1-amine.
| Compound Name | (2E,4E)-10-methoxy-2,7,10-trimethylundeca-2,4-dien-1-amine |
|---|---|
| PubChem CID | 88844803 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | (2E,4E)-10-methoxy-2,7,10-trimethylundeca-2,4-dien-1-amine |
| SMILES | COC(C)(C)CCC(C)C/C=C/C=C(\C)CN |
| InChI | InChI=1S/C15H29NO/c1-13(10-11-15(3,4)17-5)8-6-7-9-14(2)12-16/h6-7,9,13H,8,10-12,16H2,1-5H3/b7-6+,14-9+ |
| InChIKey | GJAVYKIASHCMHC-LYNMIIHYSA-N |
| XLogP | 3.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|