C23H38O3 — CID 88848239
2-ethyl-4-hydroxy-3-methyl-7-[(1S,2S)-2-octylcyclopentyl]hepta-2,4,6-trienoic acid (PubChem CID 88848239) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is 2-ethyl-4-hydroxy-3-methyl-7-[(1S,2S)-2-octylcyclopentyl]hepta-2,4,6-trienoic acid.
| Compound Name | 2-ethyl-4-hydroxy-3-methyl-7-[(1S,2S)-2-octylcyclopentyl]hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 88848239 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 2-ethyl-4-hydroxy-3-methyl-7-[(1S,2S)-2-octylcyclopentyl]hepta-2,4,6-trienoic acid |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1C=CC=C(O)C(C)=C(CC)C(=O)O |
| InChI | InChI=1S/C23H38O3/c1-4-6-7-8-9-10-13-19-14-11-15-20(19)16-12-17-22(24)18(3)21(5-2)23(25)26/h12,16-17,19-20,24H,4-11,13-15H2,1-3H3,(H,25,26)/t19-,20+/m0/s1 |
| InChIKey | YFALQYGOFNPAHU-VQTJNVASSA-N |
| XLogP | 6.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|