C15H18ClN3O3S — CID 88849281
1-chloro-3-(1,4-diazepan-1-ylsulfonyl)-6-methoxyisoquinoline (PubChem CID 88849281) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is 1-chloro-3-(1,4-diazepan-1-ylsulfonyl)-6-methoxyisoquinoline.
| Compound Name | 1-chloro-3-(1,4-diazepan-1-ylsulfonyl)-6-methoxyisoquinoline |
|---|---|
| PubChem CID | 88849281 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 1-chloro-3-(1,4-diazepan-1-ylsulfonyl)-6-methoxyisoquinoline |
| SMILES | COc1ccc2c(Cl)nc(S(=O)(=O)N3CCCNCC3)cc2c1 |
| InChI | InChI=1S/C15H18ClN3O3S/c1-22-12-3-4-13-11(9-12)10-14(18-15(13)16)23(20,21)19-7-2-5-17-6-8-19/h3-4,9-10,17H,2,5-8H2,1H3 |
| InChIKey | NYSWTCPULBDBPK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|