C28H28F3N4OP — CID 88853945
2-N-(4-diphenylphosphorylphenyl)-4-N-pentan-3-yl-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 88853945) has the molecular formula C28H28F3N4OP and a molecular weight of 524.53 g/mol. Its IUPAC name is 2-N-(4-diphenylphosphorylphenyl)-4-N-pentan-3-yl-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-diphenylphosphorylphenyl)-4-N-pentan-3-yl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 88853945 |
| Molecular Formula | C28H28F3N4OP |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2-N-(4-diphenylphosphorylphenyl)-4-N-pentan-3-yl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CCC(CC)Nc1nc(Nc2ccc(P(=O)(c3ccccc3)c3ccccc3)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C28H28F3N4OP/c1-3-20(4-2)33-26-25(28(29,30)31)19-32-27(35-26)34-21-15-17-24(18-16-21)37(36,22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-20H,3-4H2,1-2H3,(H2,32,33,34,35) |
| InChIKey | BQVGNWOIWMZSDD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|