C23H25ClN5O3P — CID 88854428
CID 88854428 (PubChem CID 88854428) has the molecular formula C23H25ClN5O3P and a molecular weight of 485.91 g/mol.
| Compound Name | CID 88854428 |
|---|---|
| PubChem CID | 88854428 |
| Molecular Formula | C23H25ClN5O3P |
| Molecular Weight | 485.91 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | — |
| SMILES | C=[P+]([O-])c1ccccc1Nc1nc(Nc2ccc(CN3CCOCC3)cc2OC)ncc1Cl |
| InChI | InChI=1S/C23H25ClN5O3P/c1-31-20-13-16(15-29-9-11-32-12-10-29)7-8-18(20)27-23-25-14-17(24)22(28-23)26-19-5-3-4-6-21(19)33(2)30/h3-8,13-14H,2,9-12,15H2,1H3,(H2,25,26,27,28) |
| InChIKey | SLWITJUVDNLMPV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.91 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|