C20H28N3O3+ — CID 8885673
3-(1,3-dioxoisoindol-2-yl)-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)propanamide (PubChem CID 8885673) has the molecular formula C20H28N3O3+ and a molecular weight of 358.46 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)propanamide |
|---|---|
| PubChem CID | 8885673 |
| Molecular Formula | C20H28N3O3+ |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)propanamide |
| SMILES | CC1(C)CC(NC(=O)CCN2C(=O)c3ccccc3C2=O)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C20H27N3O3/c1-19(2)11-13(12-20(3,4)22-19)21-16(24)9-10-23-17(25)14-7-5-6-8-15(14)18(23)26/h5-8,13,22H,9-12H2,1-4H3,(H,21,24)/p+1 |
| InChIKey | CLMBDPAEDZNFHM-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|