C38H28O10 — CID 88865786
5-(2,5-dioxooxolan-3-yl)-8-[4-[[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]methoxy]phenoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione (PubChem CID 88865786) has the molecular formula C38H28O10 and a molecular weight of 644.63 g/mol. Its IUPAC name is 5-(2,5-dioxooxolan-3-yl)-8-[4-[[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]methoxy]phenoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione.
| Compound Name | 5-(2,5-dioxooxolan-3-yl)-8-[4-[[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]methoxy]phenoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 88865786 |
| Molecular Formula | C38H28O10 |
| Molecular Weight | 644.63 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | 5-(2,5-dioxooxolan-3-yl)-8-[4-[[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]methoxy]phenoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
| SMILES | O=C1CC(C2CC3C(=O)OC(=O)C3c3cc(Oc4ccc(OCOc5ccc(/C=C/C(=O)c6ccccc6)cc5)cc4)ccc32)C(=O)O1 |
| InChI | InChI=1S/C38H28O10/c39-33(23-4-2-1-3-5-23)17-8-22-6-9-24(10-7-22)44-21-45-25-11-13-26(14-12-25)46-27-15-16-28-29(31-20-34(40)47-36(31)41)19-32-35(30(28)18-27)38(43)48-37(32)42/h1-18,29,31-32,35H,19-21H2/b17-8+ |
| InChIKey | RSSNISCJZLHMBG-CAOOACKPSA-N |
| XLogP | 6.15 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|