C40H32O11 — CID 58069069
5-(2,5-dioxooxolan-3-yl)-8-[2-[4-[hydroperoxy-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]methyl]phenoxy]ethoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione (PubChem CID 58069069) has the molecular formula C40H32O11 and a molecular weight of 688.69 g/mol. Its IUPAC name is 5-(2,5-dioxooxolan-3-yl)-8-[2-[4-[hydroperoxy-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]methyl]phenoxy]ethoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione.
| Compound Name | 5-(2,5-dioxooxolan-3-yl)-8-[2-[4-[hydroperoxy-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]methyl]phenoxy]ethoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 58069069 |
| Molecular Formula | C40H32O11 |
| Molecular Weight | 688.69 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | 5-(2,5-dioxooxolan-3-yl)-8-[2-[4-[hydroperoxy-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]methyl]phenoxy]ethoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
| SMILES | O=C1CC(C2CC3C(=O)OC(=O)C3c3cc(OCCOc4ccc(C(OO)c5ccc(/C=C/C(=O)c6ccccc6)cc5)cc4)ccc32)C(=O)O1 |
| InChI | InChI=1S/C40H32O11/c41-34(24-4-2-1-3-5-24)17-8-23-6-9-25(10-7-23)37(51-46)26-11-13-27(14-12-26)47-18-19-48-28-15-16-29-30(32-22-35(42)49-38(32)43)21-33-36(31(29)20-28)40(45)50-39(33)44/h1-17,20,30,32-33,36-37,46H,18-19,21-22H2/b17-8+ |
| InChIKey | MXFOEDHEZXJKFD-CAOOACKPSA-N |
| XLogP | 5.98 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|