C39H38O10 — CID 74060318
5-(2,5-dioxooxolan-3-yl)-8-[8-[4-(3-oxo-3-phenylprop-1-enyl)phenyl]peroxyoctoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione (PubChem CID 74060318) has the molecular formula C39H38O10 and a molecular weight of 666.72 g/mol. Its IUPAC name is 5-(2,5-dioxooxolan-3-yl)-8-[8-[4-(3-oxo-3-phenylprop-1-enyl)phenyl]peroxyoctoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione.
| Compound Name | 5-(2,5-dioxooxolan-3-yl)-8-[8-[4-(3-oxo-3-phenylprop-1-enyl)phenyl]peroxyoctoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 74060318 |
| Molecular Formula | C39H38O10 |
| Molecular Weight | 666.72 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | 5-(2,5-dioxooxolan-3-yl)-8-[8-[4-(3-oxo-3-phenylprop-1-enyl)phenyl]peroxyoctoxy]-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
| SMILES | O=C1CC(C2CC3C(=O)OC(=O)C3c3cc(OCCCCCCCCOOc4ccc(C=CC(=O)c5ccccc5)cc4)ccc32)C(=O)O1 |
| InChI | InChI=1S/C39H38O10/c40-34(26-10-6-5-7-11-26)19-14-25-12-15-27(16-13-25)49-46-21-9-4-2-1-3-8-20-45-28-17-18-29-30(32-24-35(41)47-37(32)42)23-33-36(31(29)22-28)39(44)48-38(33)43/h5-7,10-19,22,30,32-33,36H,1-4,8-9,20-21,23-24H2 |
| InChIKey | PIKFZWVQNYGZLD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|