C11H22O2 — CID 88872013
(1R)-3,4-dimethyl-1-[(2R)-oxiran-2-yl]heptan-1-ol (PubChem CID 88872013) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (1R)-3,4-dimethyl-1-[(2R)-oxiran-2-yl]heptan-1-ol.
| Compound Name | (1R)-3,4-dimethyl-1-[(2R)-oxiran-2-yl]heptan-1-ol |
|---|---|
| PubChem CID | 88872013 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (1R)-3,4-dimethyl-1-[(2R)-oxiran-2-yl]heptan-1-ol |
| SMILES | CCCC(C)C(C)C[C@@H](O)[C@H]1CO1 |
| InChI | InChI=1S/C11H22O2/c1-4-5-8(2)9(3)6-10(12)11-7-13-11/h8-12H,4-7H2,1-3H3/t8?,9?,10-,11-/m1/s1 |
| InChIKey | ISGYJXQTDKKLEE-JPPWEJMLSA-N |
| XLogP | 2.21 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|