C21H23ClF3N5O3 — CID 88872325
(1S,2R,4R)-4-[[6-chloro-5-(5-ethylfuro[2,3-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(hydroxymethyl)cyclopentan-1-ol (PubChem CID 88872325) has the molecular formula C21H23ClF3N5O3 and a molecular weight of 485.89 g/mol. Its IUPAC name is (1S,2R,4R)-4-[[6-chloro-5-(5-ethylfuro[2,3-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(hydroxymethyl)cyclopentan-1-ol.
| Compound Name | (1S,2R,4R)-4-[[6-chloro-5-(5-ethylfuro[2,3-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 88872325 |
| Molecular Formula | C21H23ClF3N5O3 |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (1S,2R,4R)-4-[[6-chloro-5-(5-ethylfuro[2,3-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(hydroxymethyl)cyclopentan-1-ol |
| SMILES | CCc1cc2cc(-c3c(Cl)nc(NCC(F)(F)F)nc3N[C@@H]3C[C@H](CO)[C@@H](O)C3)oc2cn1 |
| InChI | InChI=1S/C21H23ClF3N5O3/c1-2-12-3-10-5-15(33-16(10)7-26-12)17-18(22)29-20(27-9-21(23,24)25)30-19(17)28-13-4-11(8-31)14(32)6-13/h3,5,7,11,13-14,31-32H,2,4,6,8-9H2,1H3,(H2,27,28,29,30)/t11-,13-,14+/m1/s1 |
| InChIKey | NZOPJAHKOWEXJP-BNOWGMLFSA-N |
| XLogP | 4.02 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |