C27H15F5O — CID 88877602
10-(2,4-difluorophenyl)-2,3,6-trifluoro-9-(4-methoxyphenyl)anthracene (PubChem CID 88877602) has the molecular formula C27H15F5O and a molecular weight of 450.41 g/mol. Its IUPAC name is 10-(2,4-difluorophenyl)-2,3,6-trifluoro-9-(4-methoxyphenyl)anthracene.
| Compound Name | 10-(2,4-difluorophenyl)-2,3,6-trifluoro-9-(4-methoxyphenyl)anthracene |
|---|---|
| PubChem CID | 88877602 |
| Molecular Formula | C27H15F5O |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 10-(2,4-difluorophenyl)-2,3,6-trifluoro-9-(4-methoxyphenyl)anthracene |
| SMILES | COc1ccc(-c2c3ccc(F)cc3c(-c3ccc(F)cc3F)c3cc(F)c(F)cc23)cc1 |
| InChI | InChI=1S/C27H15F5O/c1-33-17-6-2-14(3-7-17)26-18-8-4-15(28)10-20(18)27(19-9-5-16(29)11-23(19)30)22-13-25(32)24(31)12-21(22)26/h2-13H,1H3 |
| InChIKey | FFRYJQRZGSDMCB-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|