C24H32N3O7P — CID 88878182
[(8R,13S,17S)-2-acetyl-3-[[azidooxy(methyl)phosphoryl]oxymethoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 88878182) has the molecular formula C24H32N3O7P and a molecular weight of 505.51 g/mol. Its IUPAC name is [(8R,13S,17S)-2-acetyl-3-[[azidooxy(methyl)phosphoryl]oxymethoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,13S,17S)-2-acetyl-3-[[azidooxy(methyl)phosphoryl]oxymethoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 88878182 |
| Molecular Formula | C24H32N3O7P |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | [(8R,13S,17S)-2-acetyl-3-[[azidooxy(methyl)phosphoryl]oxymethoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC2[C@@H]3CCc4cc(OCOP(C)(=O)ON=[N+]=[N-])c(C(C)=O)cc4C3CC[C@@]21C |
| InChI | InChI=1S/C24H32N3O7P/c1-14(28)19-12-20-16(11-22(19)31-13-32-35(4,30)34-27-26-25)5-6-18-17(20)9-10-24(3)21(18)7-8-23(24)33-15(2)29/h11-12,17-18,21,23H,5-10,13H2,1-4H3/t17?,18-,21?,23+,24+,35?/m1/s1 |
| InChIKey | JEZOIYQUAONAFA-OFFSRVBNSA-N |
| XLogP | 6.09 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|