C26H29N5O3 — CID 88882391
N-[6-[4-[3-(3-amino-1H-indol-5-yl)propyl]piperazin-1-yl]-2-oxochromen-3-yl]acetamide (PubChem CID 88882391) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[6-[4-[3-(3-amino-1H-indol-5-yl)propyl]piperazin-1-yl]-2-oxochromen-3-yl]acetamide.
| Compound Name | N-[6-[4-[3-(3-amino-1H-indol-5-yl)propyl]piperazin-1-yl]-2-oxochromen-3-yl]acetamide |
|---|---|
| PubChem CID | 88882391 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[6-[4-[3-(3-amino-1H-indol-5-yl)propyl]piperazin-1-yl]-2-oxochromen-3-yl]acetamide |
| SMILES | CC(=O)Nc1cc2cc(N3CCN(CCCc4ccc5[nH]cc(N)c5c4)CC3)ccc2oc1=O |
| InChI | InChI=1S/C26H29N5O3/c1-17(32)29-24-15-19-14-20(5-7-25(19)34-26(24)33)31-11-9-30(10-12-31)8-2-3-18-4-6-23-21(13-18)22(27)16-28-23/h4-7,13-16,28H,2-3,8-12,27H2,1H3,(H,29,32) |
| InChIKey | NOBGIJDCDRHKMO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|