C30H38BrN3O4 — CID 88886811
8-[4-[(4-cyanophenyl)diazenyl]phenoxy]octyl 2-bromo-2,4,4-trimethyl-5-oxohexanoate (PubChem CID 88886811) has the molecular formula C30H38BrN3O4 and a molecular weight of 584.56 g/mol. Its IUPAC name is 8-[4-[(4-cyanophenyl)diazenyl]phenoxy]octyl 2-bromo-2,4,4-trimethyl-5-oxohexanoate.
| Compound Name | 8-[4-[(4-cyanophenyl)diazenyl]phenoxy]octyl 2-bromo-2,4,4-trimethyl-5-oxohexanoate |
|---|---|
| PubChem CID | 88886811 |
| Molecular Formula | C30H38BrN3O4 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 8-[4-[(4-cyanophenyl)diazenyl]phenoxy]octyl 2-bromo-2,4,4-trimethyl-5-oxohexanoate |
| SMILES | CC(=O)C(C)(C)CC(C)(Br)C(=O)OCCCCCCCCOc1ccc(/N=N/c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C30H38BrN3O4/c1-23(35)29(2,3)22-30(4,31)28(36)38-20-10-8-6-5-7-9-19-37-27-17-15-26(16-18-27)34-33-25-13-11-24(21-32)12-14-25/h11-18H,5-10,19-20,22H2,1-4H3/b34-33+ |
| InChIKey | VYVUIWNRYFNLFE-JEIPZWNWSA-N |
| XLogP | 8.40 |
| TPSA | 101.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|