C24H20BBr — CID 88896030
CID 88896030 (PubChem CID 88896030) has the molecular formula C24H20BBr and a molecular weight of 399.14 g/mol.
| Compound Name | CID 88896030 |
|---|---|
| PubChem CID | 88896030 |
| Molecular Formula | C24H20BBr |
| Molecular Weight | 399.14 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(C)(C)c1ccc3c(c1-2)C(C)(C)c1cc(Br)ccc1-3 |
| InChI | InChI=1S/C24H20BBr/c1-23(2)18-10-9-16-15-8-6-14(26)12-20(15)24(3,4)22(16)21(18)17-7-5-13(25)11-19(17)23/h5-12H,1-4H3 |
| InChIKey | NBODITXAUFUCBK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.14 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|