C22H33FN7O9P — CID 88897611
ethyl 2-[[[(2R)-2-[1-(2-amino-6-methoxypurin-9-yl)ethoxy]-4-fluoro-3-hydroxyhex-5-ynoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate (PubChem CID 88897611) has the molecular formula C22H33FN7O9P and a molecular weight of 589.52 g/mol. Its IUPAC name is ethyl 2-[[[(2R)-2-[1-(2-amino-6-methoxypurin-9-yl)ethoxy]-4-fluoro-3-hydroxyhex-5-ynoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate.
| Compound Name | ethyl 2-[[[(2R)-2-[1-(2-amino-6-methoxypurin-9-yl)ethoxy]-4-fluoro-3-hydroxyhex-5-ynoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 88897611 |
| Molecular Formula | C22H33FN7O9P |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | ethyl 2-[[[(2R)-2-[1-(2-amino-6-methoxypurin-9-yl)ethoxy]-4-fluoro-3-hydroxyhex-5-ynoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate |
| SMILES | C#CC(F)C(O)[C@@H](COP(=O)(NCC(=O)OCC)NCC(=O)OCC)OC(C)n1cnc2c(OC)nc(N)nc21 |
| InChI | InChI=1S/C22H33FN7O9P/c1-6-14(23)19(33)15(39-13(4)30-12-25-18-20(30)28-22(24)29-21(18)35-5)11-38-40(34,26-9-16(31)36-7-2)27-10-17(32)37-8-3/h1,12-15,19,33H,7-11H2,2-5H3,(H2,24,28,29)(H2,26,27,34)/t13?,14?,15-,19?/m1/s1 |
| InChIKey | OXZOAJYHQHCTNQ-RSIWDQLISA-N |
| XLogP | 0.08 |
| TPSA | 211.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|