C9H17IN2O5 — CID 88901046
N-[2-[2-(2-aminoethoxy)propan-2-yloxy]ethyl]-3-oxo-1λ3,2-iodoxirane-1-carboxamide (PubChem CID 88901046) has the molecular formula C9H17IN2O5 and a molecular weight of 360.15 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)propan-2-yloxy]ethyl]-3-oxo-1λ3,2-iodoxirane-1-carboxamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)propan-2-yloxy]ethyl]-3-oxo-1λ3,2-iodoxirane-1-carboxamide |
|---|---|
| PubChem CID | 88901046 |
| Molecular Formula | C9H17IN2O5 |
| Molecular Weight | 360.15 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)propan-2-yloxy]ethyl]-3-oxo-1λ3,2-iodoxirane-1-carboxamide |
| SMILES | CC(C)(OCCN)OCCNC(=O)I1OC1=O |
| InChI | InChI=1S/C9H17IN2O5/c1-9(2,15-5-3-11)16-6-4-12-7(13)10-8(14)17-10/h3-6,11H2,1-2H3,(H,12,13) |
| InChIKey | PXCMIZJDZZMXLE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|