C29H42N4O6 — CID 88902719
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] N-[5-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1,4-dihydro-1,3,5-triazin-2-yl]carbamate (PubChem CID 88902719) has the molecular formula C29H42N4O6 and a molecular weight of 542.68 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] N-[5-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1,4-dihydro-1,3,5-triazin-2-yl]carbamate.
| Compound Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] N-[5-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1,4-dihydro-1,3,5-triazin-2-yl]carbamate |
|---|---|
| PubChem CID | 88902719 |
| Molecular Formula | C29H42N4O6 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] N-[5-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1,4-dihydro-1,3,5-triazin-2-yl]carbamate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COC(=O)NC2=NCN(C3CC(O)C(CO)O3)C(=O)N2)C(C)(C)CCC1 |
| InChI | InChI=1S/C29H42N4O6/c1-19(11-12-22-21(3)10-7-14-29(22,4)5)8-6-9-20(2)13-15-38-28(37)32-26-30-18-33(27(36)31-26)25-16-23(35)24(17-34)39-25/h6,8-9,11-13,23-25,34-35H,7,10,14-18H2,1-5H3,(H2,30,31,32,36,37)/b9-6+,12-11+,19-8+,20-13+ |
| InChIKey | AHCFBKSQGJLOAD-GOJWRCSBSA-N |
| XLogP | 4.05 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|