C10H20N2 — CID 88904724
N'-(2,4-dimethylpentyl)-N-ethylidenemethanimidamide (PubChem CID 88904724) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-(2,4-dimethylpentyl)-N-ethylidenemethanimidamide.
| Compound Name | N'-(2,4-dimethylpentyl)-N-ethylidenemethanimidamide |
|---|---|
| PubChem CID | 88904724 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-(2,4-dimethylpentyl)-N-ethylidenemethanimidamide |
| SMILES | C/C=N/C=N/CC(C)CC(C)C |
| InChI | InChI=1S/C10H20N2/c1-5-11-8-12-7-10(4)6-9(2)3/h5,8-10H,6-7H2,1-4H3/b11-5+,12-8+ |
| InChIKey | BPPZSGWDMUWPRT-QAZZFAKDSA-N |
| XLogP | 2.79 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|