C21H17N5O12S3 — CID 88910027
8-[[1,3-dioxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butan-2-yl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1,6-disulfonic acid (PubChem CID 88910027) has the molecular formula C21H17N5O12S3 and a molecular weight of 627.59 g/mol. Its IUPAC name is 8-[[1,3-dioxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butan-2-yl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1,6-disulfonic acid.
| Compound Name | 8-[[1,3-dioxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butan-2-yl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1,6-disulfonic acid |
|---|---|
| PubChem CID | 88910027 |
| Molecular Formula | C21H17N5O12S3 |
| Molecular Weight | 627.59 g/mol |
| Exact Mass | 627.00 |
| IUPAC Name | 8-[[1,3-dioxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butan-2-yl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1,6-disulfonic acid |
| SMILES | CC(=O)C(/N=N/c1cc(S(=O)(=O)O)cc2cc(SOOO)cc(S(=O)(=O)O)c12)C(=O)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C21H17N5O12S3/c1-9(27)19(20(28)22-11-2-3-14-15(6-11)24-21(29)23-14)26-25-16-8-13(40(31,32)33)5-10-4-12(39-38-37-30)7-17(18(10)16)41(34,35)36/h2-8,19,30H,1H3,(H,22,28)(H2,23,24,29)(H,31,32,33)(H,34,35,36)/b26-25+ |
| InChIKey | LDACAPHADNYBHF-OCEACIFDSA-N |
| XLogP | 2.61 |
| TPSA | 266.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|